C22H34FN3O2 — CID 92997251
(3R,6S)-3-N-[(2S)-butan-2-yl]-1-N-butyl-6-(4-fluoro-3-methylphenyl)piperidine-1,3-dicarboxamide (PubChem CID 92997251) has the molecular formula C22H34FN3O2 and a molecular weight of 391.53 g/mol. Its IUPAC name is (3R,6S)-3-N-[(2S)-butan-2-yl]-1-N-butyl-6-(4-fluoro-3-methylphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3R,6S)-3-N-[(2S)-butan-2-yl]-1-N-butyl-6-(4-fluoro-3-methylphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 92997251 |
| Molecular Formula | C22H34FN3O2 |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | (3R,6S)-3-N-[(2S)-butan-2-yl]-1-N-butyl-6-(4-fluoro-3-methylphenyl)piperidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)N1C[C@H](C(=O)N[C@@H](C)CC)CC[C@H]1c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C22H34FN3O2/c1-5-7-12-24-22(28)26-14-18(21(27)25-16(4)6-2)9-11-20(26)17-8-10-19(23)15(3)13-17/h8,10,13,16,18,20H,5-7,9,11-12,14H2,1-4H3,(H,24,28)(H,25,27)/t16-,18+,20-/m0/s1 |
| InChIKey | RBVAMGLQVKELCN-HQRMLTQVSA-N |
| XLogP | 4.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|