C23H27F2N3O2 — CID 46041601
3-N-butan-2-yl-1-N-(2,4-difluorophenyl)-6-phenylpiperidine-1,3-dicarboxamide (PubChem CID 46041601) has the molecular formula C23H27F2N3O2 and a molecular weight of 415.48 g/mol. Its IUPAC name is 3-N-butan-2-yl-1-N-(2,4-difluorophenyl)-6-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-butan-2-yl-1-N-(2,4-difluorophenyl)-6-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 46041601 |
| Molecular Formula | C23H27F2N3O2 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 3-N-butan-2-yl-1-N-(2,4-difluorophenyl)-6-phenylpiperidine-1,3-dicarboxamide |
| SMILES | CCC(C)NC(=O)C1CCC(c2ccccc2)N(C(=O)Nc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C23H27F2N3O2/c1-3-15(2)26-22(29)17-9-12-21(16-7-5-4-6-8-16)28(14-17)23(30)27-20-11-10-18(24)13-19(20)25/h4-8,10-11,13,15,17,21H,3,9,12,14H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | MUXYLTCZWTUWAJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |