C20H28FN3O2 — CID 93328583
(3S,6R)-1-N-butyl-6-(4-fluorophenyl)-3-N-prop-2-enylpiperidine-1,3-dicarboxamide (PubChem CID 93328583) has the molecular formula C20H28FN3O2 and a molecular weight of 361.46 g/mol. Its IUPAC name is (3S,6R)-1-N-butyl-6-(4-fluorophenyl)-3-N-prop-2-enylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S,6R)-1-N-butyl-6-(4-fluorophenyl)-3-N-prop-2-enylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 93328583 |
| Molecular Formula | C20H28FN3O2 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (3S,6R)-1-N-butyl-6-(4-fluorophenyl)-3-N-prop-2-enylpiperidine-1,3-dicarboxamide |
| SMILES | C=CCNC(=O)[C@H]1CC[C@H](c2ccc(F)cc2)N(C(=O)NCCCC)C1 |
| InChI | InChI=1S/C20H28FN3O2/c1-3-5-13-23-20(26)24-14-16(19(25)22-12-4-2)8-11-18(24)15-6-9-17(21)10-7-15/h4,6-7,9-10,16,18H,2-3,5,8,11-14H2,1H3,(H,22,25)(H,23,26)/t16-,18+/m0/s1 |
| InChIKey | CQOXORHQDWXXJW-FUHWJXTLSA-N |
| XLogP | 3.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|