C23H25FN2O2 — CID 93328515
(3S,6R)-1-(4-fluorobenzoyl)-6-(3-methylphenyl)-N-prop-2-enylpiperidine-3-carboxamide (PubChem CID 93328515) has the molecular formula C23H25FN2O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is (3S,6R)-1-(4-fluorobenzoyl)-6-(3-methylphenyl)-N-prop-2-enylpiperidine-3-carboxamide.
| Compound Name | (3S,6R)-1-(4-fluorobenzoyl)-6-(3-methylphenyl)-N-prop-2-enylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 93328515 |
| Molecular Formula | C23H25FN2O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (3S,6R)-1-(4-fluorobenzoyl)-6-(3-methylphenyl)-N-prop-2-enylpiperidine-3-carboxamide |
| SMILES | C=CCNC(=O)[C@H]1CC[C@H](c2cccc(C)c2)N(C(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H25FN2O2/c1-3-13-25-22(27)19-9-12-21(18-6-4-5-16(2)14-18)26(15-19)23(28)17-7-10-20(24)11-8-17/h3-8,10-11,14,19,21H,1,9,12-13,15H2,2H3,(H,25,27)/t19-,21+/m0/s1 |
| InChIKey | NDEVZTMEGXWQAI-PZJWPPBQSA-N |
| XLogP | 4.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|