C26H24ClFN2O2 — CID 46041479
1-(4-chlorobenzoyl)-N-[(3-fluorophenyl)methyl]-6-phenylpiperidine-3-carboxamide (PubChem CID 46041479) has the molecular formula C26H24ClFN2O2 and a molecular weight of 450.94 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-[(3-fluorophenyl)methyl]-6-phenylpiperidine-3-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-[(3-fluorophenyl)methyl]-6-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46041479 |
| Molecular Formula | C26H24ClFN2O2 |
| Molecular Weight | 450.94 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-[(3-fluorophenyl)methyl]-6-phenylpiperidine-3-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)C1CCC(c2ccccc2)N(C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H24ClFN2O2/c27-22-12-9-20(10-13-22)26(32)30-17-21(11-14-24(30)19-6-2-1-3-7-19)25(31)29-16-18-5-4-8-23(28)15-18/h1-10,12-13,15,21,24H,11,14,16-17H2,(H,29,31) |
| InChIKey | MIYRUUDSZMPRQD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.94 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |