C25H25FN2O2S — CID 46071643
N-[(3-fluorophenyl)methyl]-6-phenyl-1-(2-thiophen-2-ylacetyl)piperidine-3-carboxamide (PubChem CID 46071643) has the molecular formula C25H25FN2O2S and a molecular weight of 436.55 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-6-phenyl-1-(2-thiophen-2-ylacetyl)piperidine-3-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-6-phenyl-1-(2-thiophen-2-ylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46071643 |
| Molecular Formula | C25H25FN2O2S |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-6-phenyl-1-(2-thiophen-2-ylacetyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)C1CCC(c2ccccc2)N(C(=O)Cc2cccs2)C1 |
| InChI | InChI=1S/C25H25FN2O2S/c26-21-9-4-6-18(14-21)16-27-25(30)20-11-12-23(19-7-2-1-3-8-19)28(17-20)24(29)15-22-10-5-13-31-22/h1-10,13-14,20,23H,11-12,15-17H2,(H,27,30) |
| InChIKey | DBCXPHYMNJMKHQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |