C24H28N2O2 — CID 93001712
(3R,6S)-6-(3-methylphenyl)-1-(2-phenylacetyl)-N-prop-2-enylpiperidine-3-carboxamide (PubChem CID 93001712) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (3R,6S)-6-(3-methylphenyl)-1-(2-phenylacetyl)-N-prop-2-enylpiperidine-3-carboxamide.
| Compound Name | (3R,6S)-6-(3-methylphenyl)-1-(2-phenylacetyl)-N-prop-2-enylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 93001712 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (3R,6S)-6-(3-methylphenyl)-1-(2-phenylacetyl)-N-prop-2-enylpiperidine-3-carboxamide |
| SMILES | C=CCNC(=O)[C@@H]1CC[C@@H](c2cccc(C)c2)N(C(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H28N2O2/c1-3-14-25-24(28)21-12-13-22(20-11-7-8-18(2)15-20)26(17-21)23(27)16-19-9-5-4-6-10-19/h3-11,15,21-22H,1,12-14,16-17H2,2H3,(H,25,28)/t21-,22+/m1/s1 |
| InChIKey | UZYAXOVHUSIHBY-YADHBBJMSA-N |
| XLogP | 3.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|