C24H30N2O3 — CID 42868375
1-acetyl-N-[2-(2-methoxyphenyl)ethyl]-6-(3-methylphenyl)piperidine-3-carboxamide (PubChem CID 42868375) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-acetyl-N-[2-(2-methoxyphenyl)ethyl]-6-(3-methylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-acetyl-N-[2-(2-methoxyphenyl)ethyl]-6-(3-methylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42868375 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 1-acetyl-N-[2-(2-methoxyphenyl)ethyl]-6-(3-methylphenyl)piperidine-3-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)C1CCC(c2cccc(C)c2)N(C(C)=O)C1 |
| InChI | InChI=1S/C24H30N2O3/c1-17-7-6-9-20(15-17)22-12-11-21(16-26(22)18(2)27)24(28)25-14-13-19-8-4-5-10-23(19)29-3/h4-10,15,21-22H,11-14,16H2,1-3H3,(H,25,28) |
| InChIKey | OZJUQDRKPYDWSR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |