C22H25ClN2O — CID 93000723
(3R,6S)-1-[(3-chlorophenyl)methyl]-6-phenyl-N-prop-2-enylpiperidine-3-carboxamide (PubChem CID 93000723) has the molecular formula C22H25ClN2O and a molecular weight of 368.91 g/mol. Its IUPAC name is (3R,6S)-1-[(3-chlorophenyl)methyl]-6-phenyl-N-prop-2-enylpiperidine-3-carboxamide.
| Compound Name | (3R,6S)-1-[(3-chlorophenyl)methyl]-6-phenyl-N-prop-2-enylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 93000723 |
| Molecular Formula | C22H25ClN2O |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (3R,6S)-1-[(3-chlorophenyl)methyl]-6-phenyl-N-prop-2-enylpiperidine-3-carboxamide |
| SMILES | C=CCNC(=O)[C@@H]1CC[C@@H](c2ccccc2)N(Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C22H25ClN2O/c1-2-13-24-22(26)19-11-12-21(18-8-4-3-5-9-18)25(16-19)15-17-7-6-10-20(23)14-17/h2-10,14,19,21H,1,11-13,15-16H2,(H,24,26)/t19-,21+/m1/s1 |
| InChIKey | RCIVQIMQNVDILX-CTNGQTDRSA-N |
| XLogP | 4.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|