C23H27ClN2O2 — CID 42869813
[1-[(3-chlorophenyl)methyl]-6-phenylpiperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 42869813) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is [1-[(3-chlorophenyl)methyl]-6-phenylpiperidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[(3-chlorophenyl)methyl]-6-phenylpiperidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 42869813 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [1-[(3-chlorophenyl)methyl]-6-phenylpiperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCC(c2ccccc2)N(Cc2cccc(Cl)c2)C1)N1CCOCC1 |
| InChI | InChI=1S/C23H27ClN2O2/c24-21-8-4-5-18(15-21)16-26-17-20(23(27)25-11-13-28-14-12-25)9-10-22(26)19-6-2-1-3-7-19/h1-8,15,20,22H,9-14,16-17H2 |
| InChIKey | LHGZDJJOAPBQCW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |