C25H25ClN2O — CID 42869809
1-[(3-chlorophenyl)methyl]-N,6-diphenylpiperidine-3-carboxamide (PubChem CID 42869809) has the molecular formula C25H25ClN2O and a molecular weight of 404.94 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-N,6-diphenylpiperidine-3-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-N,6-diphenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42869809 |
| Molecular Formula | C25H25ClN2O |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-N,6-diphenylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCC(c2ccccc2)N(Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C25H25ClN2O/c26-22-11-7-8-19(16-22)17-28-18-21(25(29)27-23-12-5-2-6-13-23)14-15-24(28)20-9-3-1-4-10-20/h1-13,16,21,24H,14-15,17-18H2,(H,27,29) |
| InChIKey | XQVYYFJSLXBLHM-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |