C23H28N2O — CID 98754943
(3S,6S)-1-benzyl-N-(cyclopropylmethyl)-6-phenylpiperidine-3-carboxamide (PubChem CID 98754943) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is (3S,6S)-1-benzyl-N-(cyclopropylmethyl)-6-phenylpiperidine-3-carboxamide.
| Compound Name | (3S,6S)-1-benzyl-N-(cyclopropylmethyl)-6-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 98754943 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (3S,6S)-1-benzyl-N-(cyclopropylmethyl)-6-phenylpiperidine-3-carboxamide |
| SMILES | O=C(NCC1CC1)[C@H]1CC[C@@H](c2ccccc2)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H28N2O/c26-23(24-15-18-11-12-18)21-13-14-22(20-9-5-2-6-10-20)25(17-21)16-19-7-3-1-4-8-19/h1-10,18,21-22H,11-17H2,(H,24,26)/t21-,22-/m0/s1 |
| InChIKey | YMOSAYYMOZAAQK-VXKWHMMOSA-N |
| XLogP | 4.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |