C27H29FN2O3 — CID 42870440
1-benzyl-N-(2,4-dimethoxyphenyl)-6-(4-fluorophenyl)piperidine-3-carboxamide (PubChem CID 42870440) has the molecular formula C27H29FN2O3 and a molecular weight of 448.54 g/mol. Its IUPAC name is 1-benzyl-N-(2,4-dimethoxyphenyl)-6-(4-fluorophenyl)piperidine-3-carboxamide.
| Compound Name | 1-benzyl-N-(2,4-dimethoxyphenyl)-6-(4-fluorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42870440 |
| Molecular Formula | C27H29FN2O3 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 1-benzyl-N-(2,4-dimethoxyphenyl)-6-(4-fluorophenyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCC(c3ccc(F)cc3)N(Cc3ccccc3)C2)c(OC)c1 |
| InChI | InChI=1S/C27H29FN2O3/c1-32-23-13-14-24(26(16-23)33-2)29-27(31)21-10-15-25(20-8-11-22(28)12-9-20)30(18-21)17-19-6-4-3-5-7-19/h3-9,11-14,16,21,25H,10,15,17-18H2,1-2H3,(H,29,31) |
| InChIKey | CRYUMTWCCRVSCH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |