C28H31N3O4 — CID 42868538
1-N-benzyl-3-N-(2,4-dimethoxyphenyl)-6-phenylpiperidine-1,3-dicarboxamide (PubChem CID 42868538) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is 1-N-benzyl-3-N-(2,4-dimethoxyphenyl)-6-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-benzyl-3-N-(2,4-dimethoxyphenyl)-6-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 42868538 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 1-N-benzyl-3-N-(2,4-dimethoxyphenyl)-6-phenylpiperidine-1,3-dicarboxamide |
| SMILES | COc1ccc(NC(=O)C2CCC(c3ccccc3)N(C(=O)NCc3ccccc3)C2)c(OC)c1 |
| InChI | InChI=1S/C28H31N3O4/c1-34-23-14-15-24(26(17-23)35-2)30-27(32)22-13-16-25(21-11-7-4-8-12-21)31(19-22)28(33)29-18-20-9-5-3-6-10-20/h3-12,14-15,17,22,25H,13,16,18-19H2,1-2H3,(H,29,33)(H,30,32) |
| InChIKey | DQOFDRVSFCAFQW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |