C28H31N3O2 — CID 99768177
(3R,6S)-1-N-benzyl-6-phenyl-3-N-[(1S)-1-phenylethyl]piperidine-1,3-dicarboxamide (PubChem CID 99768177) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is (3R,6S)-1-N-benzyl-6-phenyl-3-N-[(1S)-1-phenylethyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R,6S)-1-N-benzyl-6-phenyl-3-N-[(1S)-1-phenylethyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 99768177 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (3R,6S)-1-N-benzyl-6-phenyl-3-N-[(1S)-1-phenylethyl]piperidine-1,3-dicarboxamide |
| SMILES | C[C@H](NC(=O)[C@@H]1CC[C@@H](c2ccccc2)N(C(=O)NCc2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C28H31N3O2/c1-21(23-13-7-3-8-14-23)30-27(32)25-17-18-26(24-15-9-4-10-16-24)31(20-25)28(33)29-19-22-11-5-2-6-12-22/h2-16,21,25-26H,17-20H2,1H3,(H,29,33)(H,30,32)/t21-,25+,26-/m0/s1 |
| InChIKey | OYYHRMLMOQQSLS-BYXVTNLJSA-N |
| XLogP | 5.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |