C28H32N4O2 — CID 46069441
1-N-benzyl-3-N-[4-(dimethylamino)phenyl]-6-phenylpiperidine-1,3-dicarboxamide (PubChem CID 46069441) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-N-benzyl-3-N-[4-(dimethylamino)phenyl]-6-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-benzyl-3-N-[4-(dimethylamino)phenyl]-6-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 46069441 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 1-N-benzyl-3-N-[4-(dimethylamino)phenyl]-6-phenylpiperidine-1,3-dicarboxamide |
| SMILES | CN(C)c1ccc(NC(=O)C2CCC(c3ccccc3)N(C(=O)NCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C28H32N4O2/c1-31(2)25-16-14-24(15-17-25)30-27(33)23-13-18-26(22-11-7-4-8-12-22)32(20-23)28(34)29-19-21-9-5-3-6-10-21/h3-12,14-17,23,26H,13,18-20H2,1-2H3,(H,29,34)(H,30,33) |
| InChIKey | PSOGBCKPKURZID-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|