C29H31F2N3O — CID 42870479
[1-benzyl-6-(4-fluorophenyl)piperidin-3-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 42870479) has the molecular formula C29H31F2N3O and a molecular weight of 475.58 g/mol. Its IUPAC name is [1-benzyl-6-(4-fluorophenyl)piperidin-3-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-benzyl-6-(4-fluorophenyl)piperidin-3-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42870479 |
| Molecular Formula | C29H31F2N3O |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | [1-benzyl-6-(4-fluorophenyl)piperidin-3-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCC(c2ccc(F)cc2)N(Cc2ccccc2)C1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C29H31F2N3O/c30-25-13-10-23(11-14-25)27-15-12-24(21-34(27)20-22-6-2-1-3-7-22)29(35)33-18-16-32(17-19-33)28-9-5-4-8-26(28)31/h1-11,13-14,24,27H,12,15-21H2 |
| InChIKey | FAQPOLMPIINYED-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |