C30H33FN4O2 — CID 46069411
N-benzyl-3-[4-(2-fluorophenyl)piperazine-1-carbonyl]-5-phenylpiperidine-1-carboxamide (PubChem CID 46069411) has the molecular formula C30H33FN4O2 and a molecular weight of 500.62 g/mol. Its IUPAC name is N-benzyl-3-[4-(2-fluorophenyl)piperazine-1-carbonyl]-5-phenylpiperidine-1-carboxamide.
| Compound Name | N-benzyl-3-[4-(2-fluorophenyl)piperazine-1-carbonyl]-5-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 46069411 |
| Molecular Formula | C30H33FN4O2 |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | N-benzyl-3-[4-(2-fluorophenyl)piperazine-1-carbonyl]-5-phenylpiperidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CC(C(=O)N2CCN(c3ccccc3F)CC2)CC(c2ccccc2)C1 |
| InChI | InChI=1S/C30H33FN4O2/c31-27-13-7-8-14-28(27)33-15-17-34(18-16-33)29(36)26-19-25(24-11-5-2-6-12-24)21-35(22-26)30(37)32-20-23-9-3-1-4-10-23/h1-14,25-26H,15-22H2,(H,32,37) |
| InChIKey | POGXDDNCRFULNQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |