C26H30ClN3O2 — CID 50807615
[1-[[1-[(3-chlorophenyl)methyl]indol-2-yl]methyl]piperidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 50807615) has the molecular formula C26H30ClN3O2 and a molecular weight of 452.00 g/mol. Its IUPAC name is [1-[[1-[(3-chlorophenyl)methyl]indol-2-yl]methyl]piperidin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[[1-[(3-chlorophenyl)methyl]indol-2-yl]methyl]piperidin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 50807615 |
| Molecular Formula | C26H30ClN3O2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | [1-[[1-[(3-chlorophenyl)methyl]indol-2-yl]methyl]piperidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCN(Cc2cc3ccccc3n2Cc2cccc(Cl)c2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C26H30ClN3O2/c27-23-6-3-4-20(16-23)18-30-24(17-22-5-1-2-7-25(22)30)19-28-10-8-21(9-11-28)26(31)29-12-14-32-15-13-29/h1-7,16-17,21H,8-15,18-19H2 |
| InChIKey | YUOFUGNUADPPQO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |