C21H18N2OS — CID 42780998
(4-phenylphenyl)-(2-pyridin-4-yl-1,3-thiazolidin-3-yl)methanone (PubChem CID 42780998) has the molecular formula C21H18N2OS and a molecular weight of 346.46 g/mol. Its IUPAC name is (4-phenylphenyl)-(2-pyridin-4-yl-1,3-thiazolidin-3-yl)methanone.
| Compound Name | (4-phenylphenyl)-(2-pyridin-4-yl-1,3-thiazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 42780998 |
| Molecular Formula | C21H18N2OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (4-phenylphenyl)-(2-pyridin-4-yl-1,3-thiazolidin-3-yl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)N1CCSC1c1ccncc1 |
| InChI | InChI=1S/C21H18N2OS/c24-20(23-14-15-25-21(23)19-10-12-22-13-11-19)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h1-13,21H,14-15H2 |
| InChIKey | AARQTHWYDPAGCD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |