About [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone
[2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone (PubChem CID 122329030) has the molecular formula C20H16BrNOS2
and a molecular weight of 430.39 g/mol. Its IUPAC name is [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone.
Molecular Properties
| Compound Name | [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone |
| PubChem CID | 122329030 |
| Molecular Formula | C20H16BrNOS2 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 428.99 |
| IUPAC Name | [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2cccs2)cc1)N1CCSC1c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16BrNOS2/c21-17-9-7-16(8-10-17)20-22(11-13-25-20)19(23)15-5-3-14(4-6-15)18-2-1-12-24-18/h1-10,12,20H,11,13H2 |
| InChIKey | NQSOKXIJJCXZKW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone?
The IUPAC name of [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone (CID 122329030) is [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone.
What is the SMILES notation for [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone?
The canonical SMILES for [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone is O=C(c1ccc(-c2cccs2)cc1)N1CCSC1c1ccc(Br)cc1.
What is the InChIKey of [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone?
The InChIKey is NQSOKXIJJCXZKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16BrNOS2/c21-17-9-7-16(8-10-17)20-22(11-13-25-20)19(23)15-5-3-14(4-6-15)18-2-1-12-24-18/h1-10,12,20H,11,13H2.
What are the key properties of [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone?
[2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone has a molecular weight of 430.39 g/mol, XLogP of 6.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromophenyl)-1,3-thiazolidin-3-yl]-(4-thiophen-2-ylphenyl)methanone is sourced from PubChem (CID 122329030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).