About 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid
2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 116697506) has the molecular formula C11H14N2O3S2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 116697506 |
| Molecular Formula | C11H14N2O3S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | CC1SCCN(C(=O)c2nc(C(=O)O)cs2)C1C |
| InChI | InChI=1S/C11H14N2O3S2/c1-6-7(2)17-4-3-13(6)10(14)9-12-8(5-18-9)11(15)16/h5-7H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | LHAVUKJWENKOAO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid (CID 116697506) is 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid is CC1SCCN(C(=O)c2nc(C(=O)O)cs2)C1C.
What is the InChIKey of 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is LHAVUKJWENKOAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3S2/c1-6-7(2)17-4-3-13(6)10(14)9-12-8(5-18-9)11(15)16/h5-7H,3-4H2,1-2H3,(H,15,16).
What are the key properties of 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid?
2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 286.38 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylthiomorpholine-4-carbonyl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 116697506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).