C21H19FN2O2 — CID 70770427
[2-(4-fluorophenyl)piperidin-1-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone (PubChem CID 70770427) has the molecular formula C21H19FN2O2 and a molecular weight of 350.39 g/mol. Its IUPAC name is [2-(4-fluorophenyl)piperidin-1-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone.
| Compound Name | [2-(4-fluorophenyl)piperidin-1-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 70770427 |
| Molecular Formula | C21H19FN2O2 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | [2-(4-fluorophenyl)piperidin-1-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)on1)N1CCCCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN2O2/c22-17-11-9-15(10-12-17)19-8-4-5-13-24(19)21(25)18-14-20(26-23-18)16-6-2-1-3-7-16/h1-3,6-7,9-12,14,19H,4-5,8,13H2 |
| InChIKey | YAZHYVICILXTGD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |