C19H19N3O5 — CID 20952719
ethyl 4-[[3-(2,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]amino]benzoate (PubChem CID 20952719) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is ethyl 4-[[3-(2,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]amino]benzoate.
| Compound Name | ethyl 4-[[3-(2,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 20952719 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | ethyl 4-[[3-(2,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(-c3cc(OC)ccc3OC)no2)cc1 |
| InChI | InChI=1S/C19H19N3O5/c1-4-26-18(23)12-5-7-13(8-6-12)20-19-21-17(22-27-19)15-11-14(24-2)9-10-16(15)25-3/h5-11H,4H2,1-3H3,(H,20,21,22) |
| InChIKey | SLBRJQIXKUYOFO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |