C29H28N2O3S — CID 143737114
ethyl 4-[2-[(2-tert-butyl-6-phenylphenyl)carbamoyl]-1,3-thiazol-4-yl]benzoate (PubChem CID 143737114) has the molecular formula C29H28N2O3S and a molecular weight of 484.62 g/mol. Its IUPAC name is ethyl 4-[2-[(2-tert-butyl-6-phenylphenyl)carbamoyl]-1,3-thiazol-4-yl]benzoate.
| Compound Name | ethyl 4-[2-[(2-tert-butyl-6-phenylphenyl)carbamoyl]-1,3-thiazol-4-yl]benzoate |
|---|---|
| PubChem CID | 143737114 |
| Molecular Formula | C29H28N2O3S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | ethyl 4-[2-[(2-tert-butyl-6-phenylphenyl)carbamoyl]-1,3-thiazol-4-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2csc(C(=O)Nc3c(-c4ccccc4)cccc3C(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C29H28N2O3S/c1-5-34-28(33)21-16-14-20(15-17-21)24-18-35-27(30-24)26(32)31-25-22(19-10-7-6-8-11-19)12-9-13-23(25)29(2,3)4/h6-18H,5H2,1-4H3,(H,31,32) |
| InChIKey | GCCBWJWULZUPAW-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |