C20H20N4O3 — CID 138989702
ethyl 4-[[2-(5-ethyl-1H-1,2,4-triazol-3-yl)phenyl]carbamoyl]benzoate (PubChem CID 138989702) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is ethyl 4-[[2-(5-ethyl-1H-1,2,4-triazol-3-yl)phenyl]carbamoyl]benzoate.
| Compound Name | ethyl 4-[[2-(5-ethyl-1H-1,2,4-triazol-3-yl)phenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 138989702 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | ethyl 4-[[2-(5-ethyl-1H-1,2,4-triazol-3-yl)phenyl]carbamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(=O)Nc2ccccc2-c2n[nH]c(CC)n2)cc1 |
| InChI | InChI=1S/C20H20N4O3/c1-3-17-22-18(24-23-17)15-7-5-6-8-16(15)21-19(25)13-9-11-14(12-10-13)20(26)27-4-2/h5-12H,3-4H2,1-2H3,(H,21,25)(H,22,23,24) |
| InChIKey | ADKMFFAADIYEDH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |