C18H18N4O2S — CID 138989499
N-[2-(5-ethyl-1H-1,2,4-triazol-3-yl)phenyl]-4-methylsulfinylbenzamide (PubChem CID 138989499) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is N-[2-(5-ethyl-1H-1,2,4-triazol-3-yl)phenyl]-4-methylsulfinylbenzamide.
| Compound Name | N-[2-(5-ethyl-1H-1,2,4-triazol-3-yl)phenyl]-4-methylsulfinylbenzamide |
|---|---|
| PubChem CID | 138989499 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[2-(5-ethyl-1H-1,2,4-triazol-3-yl)phenyl]-4-methylsulfinylbenzamide |
| SMILES | CCc1nc(-c2ccccc2NC(=O)c2ccc(S(C)=O)cc2)n[nH]1 |
| InChI | InChI=1S/C18H18N4O2S/c1-3-16-20-17(22-21-16)14-6-4-5-7-15(14)19-18(23)12-8-10-13(11-9-12)25(2)24/h4-11H,3H2,1-2H3,(H,19,23)(H,20,21,22) |
| InChIKey | SQRWBHLUBCBLDB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |