C23H32N4O2S2 — CID 144612117
3-(4-phenyl-1,3-thiazol-2-yl)-N-propan-2-yl-1-[3-(trimethyl-λ4-sulfanyl)propoxymethyl]pyrazole-4-carboxamide (PubChem CID 144612117) has the molecular formula C23H32N4O2S2 and a molecular weight of 460.67 g/mol. Its IUPAC name is 3-(4-phenyl-1,3-thiazol-2-yl)-N-propan-2-yl-1-[3-(trimethyl-λ4-sulfanyl)propoxymethyl]pyrazole-4-carboxamide.
| Compound Name | 3-(4-phenyl-1,3-thiazol-2-yl)-N-propan-2-yl-1-[3-(trimethyl-λ4-sulfanyl)propoxymethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144612117 |
| Molecular Formula | C23H32N4O2S2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 3-(4-phenyl-1,3-thiazol-2-yl)-N-propan-2-yl-1-[3-(trimethyl-λ4-sulfanyl)propoxymethyl]pyrazole-4-carboxamide |
| SMILES | CC(C)NC(=O)c1cn(COCCCS(C)(C)C)nc1-c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H32N4O2S2/c1-17(2)24-22(28)19-14-27(16-29-12-9-13-31(3,4)5)26-21(19)23-25-20(15-30-23)18-10-7-6-8-11-18/h6-8,10-11,14-15,17H,9,12-13,16H2,1-5H3,(H,24,28) |
| InChIKey | UQSPWVOSEKJWRU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|