C23H34FN5O2Si — CID 166058210
1-[1-(2-fluoro-6-methylphenyl)piperidin-4-yl]-7-(2-trimethylsilylethoxymethyl)-3,6-dihydropurin-2-one (PubChem CID 166058210) has the molecular formula C23H34FN5O2Si and a molecular weight of 459.64 g/mol. Its IUPAC name is 1-[1-(2-fluoro-6-methylphenyl)piperidin-4-yl]-7-(2-trimethylsilylethoxymethyl)-3,6-dihydropurin-2-one.
| Compound Name | 1-[1-(2-fluoro-6-methylphenyl)piperidin-4-yl]-7-(2-trimethylsilylethoxymethyl)-3,6-dihydropurin-2-one |
|---|---|
| PubChem CID | 166058210 |
| Molecular Formula | C23H34FN5O2Si |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 1-[1-(2-fluoro-6-methylphenyl)piperidin-4-yl]-7-(2-trimethylsilylethoxymethyl)-3,6-dihydropurin-2-one |
| SMILES | Cc1cccc(F)c1N1CCC(N2Cc3c(ncn3COCC[Si](C)(C)C)NC2=O)CC1 |
| InChI | InChI=1S/C23H34FN5O2Si/c1-17-6-5-7-19(24)21(17)27-10-8-18(9-11-27)29-14-20-22(26-23(29)30)25-15-28(20)16-31-12-13-32(2,3)4/h5-7,15,18H,8-14,16H2,1-4H3,(H,26,30) |
| InChIKey | XQZVCSMMXDFMOS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|