C22H34FN5O3Si — CID 166058239
1-(2-fluoro-6-methylphenyl)-N-[[4-nitro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]methyl]piperidin-4-amine (PubChem CID 166058239) has the molecular formula C22H34FN5O3Si and a molecular weight of 463.63 g/mol. Its IUPAC name is 1-(2-fluoro-6-methylphenyl)-N-[[4-nitro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]methyl]piperidin-4-amine.
| Compound Name | 1-(2-fluoro-6-methylphenyl)-N-[[4-nitro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 166058239 |
| Molecular Formula | C22H34FN5O3Si |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 1-(2-fluoro-6-methylphenyl)-N-[[4-nitro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]methyl]piperidin-4-amine |
| SMILES | Cc1cccc(F)c1N1CCC(NCc2c([N+](=O)[O-])cnn2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C22H34FN5O3Si/c1-17-6-5-7-19(23)22(17)26-10-8-18(9-11-26)24-14-20-21(28(29)30)15-25-27(20)16-31-12-13-32(2,3)4/h5-7,15,18,24H,8-14,16H2,1-4H3 |
| InChIKey | KQYDLVAHWCADGU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|