C10H17N3O — CID 102731415
trans-(1S,2S)-2-[(1-methylpyrazol-4-yl)amino]cyclohexan-1-ol (PubChem CID 102731415) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(1-methylpyrazol-4-yl)amino]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[(1-methylpyrazol-4-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731415 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | trans-(1S,2S)-2-[(1-methylpyrazol-4-yl)amino]cyclohexan-1-ol |
| SMILES | Cn1cc(N[C@H]2CCCC[C@@H]2O)cn1 |
| InChI | InChI=1S/C10H17N3O/c1-13-7-8(6-11-13)12-9-4-2-3-5-10(9)14/h6-7,9-10,12,14H,2-5H2,1H3/t9-,10-/m0/s1 |
| InChIKey | XHQQSKMIEYFHTK-UWVGGRQHSA-N |
| XLogP | 1.14 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |