C23H28N6OSi — CID 58431343
4-[1-[1-(cyanomethyl)cyclobutyl]pyrazol-4-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonitrile (PubChem CID 58431343) has the molecular formula C23H28N6OSi and a molecular weight of 432.60 g/mol. Its IUPAC name is 4-[1-[1-(cyanomethyl)cyclobutyl]pyrazol-4-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 4-[1-[1-(cyanomethyl)cyclobutyl]pyrazol-4-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 58431343 |
| Molecular Formula | C23H28N6OSi |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 4-[1-[1-(cyanomethyl)cyclobutyl]pyrazol-4-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4(CC#N)CCC4)c3)c(C#N)cnc21 |
| InChI | InChI=1S/C23H28N6OSi/c1-31(2,3)12-11-30-17-28-10-5-20-21(18(13-25)14-26-22(20)28)19-15-27-29(16-19)23(8-9-24)6-4-7-23/h5,10,14-16H,4,6-8,11-12,17H2,1-3H3 |
| InChIKey | UUNPYQOJFUNBGC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 92.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|