C28H34N4O3 — CID 67131639
tert-butyl N-[3-(4-cyanophenoxy)propyl]-N-[1-[(4-cyanophenyl)methyl]piperidin-4-yl]carbamate (PubChem CID 67131639) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is tert-butyl N-[3-(4-cyanophenoxy)propyl]-N-[1-[(4-cyanophenyl)methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[3-(4-cyanophenoxy)propyl]-N-[1-[(4-cyanophenyl)methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 67131639 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | tert-butyl N-[3-(4-cyanophenoxy)propyl]-N-[1-[(4-cyanophenyl)methyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCOc1ccc(C#N)cc1)C1CCN(Cc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C28H34N4O3/c1-28(2,3)35-27(33)32(15-4-18-34-26-11-9-23(20-30)10-12-26)25-13-16-31(17-14-25)21-24-7-5-22(19-29)6-8-24/h5-12,25H,4,13-18,21H2,1-3H3 |
| InChIKey | AFZIWEVLNHUXMJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 89.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|