C20H29N3O3 — CID 58996527
tert-butyl N-[3-(4-isocyanophenoxy)propyl]-N-piperidin-4-ylcarbamate (PubChem CID 58996527) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl N-[3-(4-isocyanophenoxy)propyl]-N-piperidin-4-ylcarbamate.
| Compound Name | tert-butyl N-[3-(4-isocyanophenoxy)propyl]-N-piperidin-4-ylcarbamate |
|---|---|
| PubChem CID | 58996527 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | tert-butyl N-[3-(4-isocyanophenoxy)propyl]-N-piperidin-4-ylcarbamate |
| SMILES | [C-]#[N+]c1ccc(OCCCN(C(=O)OC(C)(C)C)C2CCNCC2)cc1 |
| InChI | InChI=1S/C20H29N3O3/c1-20(2,3)26-19(24)23(17-10-12-22-13-11-17)14-5-15-25-18-8-6-16(21-4)7-9-18/h6-9,17,22H,5,10-15H2,1-3H3 |
| InChIKey | XOAJNRYDIZJOSU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|