About bromomethane;2-chloro-3-fluoro-5-methylpyridine
bromomethane;2-chloro-3-fluoro-5-methylpyridine (PubChem CID 143545285) has the molecular formula C7H8BrClFN
and a molecular weight of 240.50 g/mol. Its IUPAC name is bromomethane;2-chloro-3-fluoro-5-methylpyridine.
Molecular Properties
| Compound Name | bromomethane;2-chloro-3-fluoro-5-methylpyridine |
| PubChem CID | 143545285 |
| Molecular Formula | C7H8BrClFN |
| Molecular Weight | 240.50 g/mol |
| Exact Mass | 238.95 |
| IUPAC Name | bromomethane;2-chloro-3-fluoro-5-methylpyridine |
| SMILES | CBr.Cc1cnc(Cl)c(F)c1 |
| InChI | InChI=1S/C6H5ClFN.CH3Br/c1-4-2-5(8)6(7)9-3-4;1-2/h2-3H,1H3;1H3 |
| InChIKey | LGFGRQJHKNCGQI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromomethane;2-chloro-3-fluoro-5-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethane;2-chloro-3-fluoro-5-methylpyridine?
The IUPAC name of bromomethane;2-chloro-3-fluoro-5-methylpyridine (CID 143545285) is bromomethane;2-chloro-3-fluoro-5-methylpyridine.
What is the SMILES notation for bromomethane;2-chloro-3-fluoro-5-methylpyridine?
The canonical SMILES for bromomethane;2-chloro-3-fluoro-5-methylpyridine is CBr.Cc1cnc(Cl)c(F)c1.
What is the InChIKey of bromomethane;2-chloro-3-fluoro-5-methylpyridine?
The InChIKey is LGFGRQJHKNCGQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClFN.CH3Br/c1-4-2-5(8)6(7)9-3-4;1-2/h2-3H,1H3;1H3.
What are the key properties of bromomethane;2-chloro-3-fluoro-5-methylpyridine?
bromomethane;2-chloro-3-fluoro-5-methylpyridine has a molecular weight of 240.50 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethane;2-chloro-3-fluoro-5-methylpyridine is sourced from PubChem (CID 143545285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).