C19H21ClF2N2O4 — CID 167706434
2-chloro-3-fluoro-5-methylpyridine;diethyl 2-(3-fluoro-5-methyl-2-pyridinyl)propanedioate (PubChem CID 167706434) has the molecular formula C19H21ClF2N2O4 and a molecular weight of 414.84 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-methylpyridine;diethyl 2-(3-fluoro-5-methyl-2-pyridinyl)propanedioate.
| Compound Name | 2-chloro-3-fluoro-5-methylpyridine;diethyl 2-(3-fluoro-5-methyl-2-pyridinyl)propanedioate |
|---|---|
| PubChem CID | 167706434 |
| Molecular Formula | C19H21ClF2N2O4 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-chloro-3-fluoro-5-methylpyridine;diethyl 2-(3-fluoro-5-methyl-2-pyridinyl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ncc(C)cc1F.Cc1cnc(Cl)c(F)c1 |
| InChI | InChI=1S/C13H16FNO4.C6H5ClFN/c1-4-18-12(16)10(13(17)19-5-2)11-9(14)6-8(3)7-15-11;1-4-2-5(8)6(7)9-3-4/h6-7,10H,4-5H2,1-3H3;2-3H,1H3 |
| InChIKey | ZDZPWOLLEKZYQZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|