About diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate
diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate (PubChem CID 159674340) has the molecular formula C21H24F2N2O6
and a molecular weight of 438.43 g/mol. Its IUPAC name is diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate.
Molecular Properties
| Compound Name | diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate |
| PubChem CID | 159674340 |
| Molecular Formula | C21H24F2N2O6 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ncccc1F.CCOC(=O)Cc1ncccc1F |
| InChI | InChI=1S/C12H14FNO4.C9H10FNO2/c1-3-17-11(15)9(12(16)18-4-2)10-8(13)6-5-7-14-10;1-2-13-9(12)6-8-7(10)4-3-5-11-8/h5-7,9H,3-4H2,1-2H3;3-5H,2,6H2,1H3 |
| InChIKey | MUKDHJAUOLTVSF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate?
The IUPAC name of diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate (CID 159674340) is diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate.
What is the SMILES notation for diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate?
The canonical SMILES for diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate is CCOC(=O)C(C(=O)OCC)c1ncccc1F.CCOC(=O)Cc1ncccc1F.
What is the InChIKey of diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate?
The InChIKey is MUKDHJAUOLTVSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO4.C9H10FNO2/c1-3-17-11(15)9(12(16)18-4-2)10-8(13)6-5-7-14-10;1-2-13-9(12)6-8-7(10)4-3-5-11-8/h5-7,9H,3-4H2,1-2H3;3-5H,2,6H2,1H3.
What are the key properties of diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate?
diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate has a molecular weight of 438.43 g/mol, XLogP of 2.76, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(3-fluoro-2-pyridinyl)propanedioate;ethyl 2-(3-fluoro-2-pyridinyl)acetate is sourced from PubChem (CID 159674340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).