C9H12N2O4S — CID 141212885
ethyl 2-(3-sulfamoyl-2-pyridinyl)acetate (PubChem CID 141212885) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is ethyl 2-(3-sulfamoyl-2-pyridinyl)acetate.
| Compound Name | ethyl 2-(3-sulfamoyl-2-pyridinyl)acetate |
|---|---|
| PubChem CID | 141212885 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | ethyl 2-(3-sulfamoyl-2-pyridinyl)acetate |
| SMILES | CCOC(=O)Cc1ncccc1S(N)(=O)=O |
| InChI | InChI=1S/C9H12N2O4S/c1-2-15-9(12)6-7-8(16(10,13)14)4-3-5-11-7/h3-5H,2,6H2,1H3,(H2,10,13,14) |
| InChIKey | ZJXGNWOYVNPUDQ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |