C13H15F3N2O5 — CID 164753853
[6-(1,3-diethoxy-1,3-dioxopropan-2-yl)-5-(trifluoromethyl)-3-pyridinyl]-oxidoazanium (PubChem CID 164753853) has the molecular formula C13H15F3N2O5 and a molecular weight of 336.27 g/mol. Its IUPAC name is [6-(1,3-diethoxy-1,3-dioxopropan-2-yl)-5-(trifluoromethyl)-3-pyridinyl]-oxidoazanium.
| Compound Name | [6-(1,3-diethoxy-1,3-dioxopropan-2-yl)-5-(trifluoromethyl)-3-pyridinyl]-oxidoazanium |
|---|---|
| PubChem CID | 164753853 |
| Molecular Formula | C13H15F3N2O5 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [6-(1,3-diethoxy-1,3-dioxopropan-2-yl)-5-(trifluoromethyl)-3-pyridinyl]-oxidoazanium |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ncc([NH2+][O-])cc1C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2O5/c1-3-22-11(19)9(12(20)23-4-2)10-8(13(14,15)16)5-7(18-21)6-17-10/h5-6,9H,3-4,18H2,1-2H3 |
| InChIKey | NOIKCGXRNSNLEG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|