C14H16F3NO4 — CID 121265745
diethyl 2-[3-amino-4-(trifluoromethyl)phenyl]propanedioate (PubChem CID 121265745) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is diethyl 2-[3-amino-4-(trifluoromethyl)phenyl]propanedioate.
| Compound Name | diethyl 2-[3-amino-4-(trifluoromethyl)phenyl]propanedioate |
|---|---|
| PubChem CID | 121265745 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | diethyl 2-[3-amino-4-(trifluoromethyl)phenyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ccc(C(F)(F)F)c(N)c1 |
| InChI | InChI=1S/C14H16F3NO4/c1-3-21-12(19)11(13(20)22-4-2)8-5-6-9(10(18)7-8)14(15,16)17/h5-7,11H,3-4,18H2,1-2H3 |
| InChIKey | HTERVLIXCCGKFZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|