C15H13ClF2N2O — CID 146985648
2-chloro-N-[(1S)-1-(3,4-difluorophenyl)ethyl]-5-methylpyridine-3-carboxamide (PubChem CID 146985648) has the molecular formula C15H13ClF2N2O and a molecular weight of 310.73 g/mol. Its IUPAC name is 2-chloro-N-[(1S)-1-(3,4-difluorophenyl)ethyl]-5-methylpyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(1S)-1-(3,4-difluorophenyl)ethyl]-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 146985648 |
| Molecular Formula | C15H13ClF2N2O |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-chloro-N-[(1S)-1-(3,4-difluorophenyl)ethyl]-5-methylpyridine-3-carboxamide |
| SMILES | Cc1cnc(Cl)c(C(=O)N[C@@H](C)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C15H13ClF2N2O/c1-8-5-11(14(16)19-7-8)15(21)20-9(2)10-3-4-12(17)13(18)6-10/h3-7,9H,1-2H3,(H,20,21)/t9-/m0/s1 |
| InChIKey | APEMENSHFZHKRB-VIFPVBQESA-N |
| XLogP | 3.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|