C13H20Cl2N2O2 — CID 103491550
3,5-dichloro-6-(1-ethoxypropan-2-yloxy)-N-propylpyridin-2-amine (PubChem CID 103491550) has the molecular formula C13H20Cl2N2O2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 3,5-dichloro-6-(1-ethoxypropan-2-yloxy)-N-propylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(1-ethoxypropan-2-yloxy)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 103491550 |
| Molecular Formula | C13H20Cl2N2O2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3,5-dichloro-6-(1-ethoxypropan-2-yloxy)-N-propylpyridin-2-amine |
| SMILES | CCCNc1nc(OC(C)COCC)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H20Cl2N2O2/c1-4-6-16-12-10(14)7-11(15)13(17-12)19-9(3)8-18-5-2/h7,9H,4-6,8H2,1-3H3,(H,16,17) |
| InChIKey | CJKYSIHUIQVVDK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |