C10H15Cl2N3O — CID 102989713
(3,5-dichloro-6-pentan-2-yloxy-2-pyridinyl)hydrazine (PubChem CID 102989713) has the molecular formula C10H15Cl2N3O and a molecular weight of 264.16 g/mol. Its IUPAC name is (3,5-dichloro-6-pentan-2-yloxy-2-pyridinyl)hydrazine.
| Compound Name | (3,5-dichloro-6-pentan-2-yloxy-2-pyridinyl)hydrazine |
|---|---|
| PubChem CID | 102989713 |
| Molecular Formula | C10H15Cl2N3O |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (3,5-dichloro-6-pentan-2-yloxy-2-pyridinyl)hydrazine |
| SMILES | CCCC(C)Oc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H15Cl2N3O/c1-3-4-6(2)16-10-8(12)5-7(11)9(14-10)15-13/h5-6H,3-4,13H2,1-2H3,(H,14,15) |
| InChIKey | VXWXCVMARNXPRH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|