C8H5Cl2F6N3O — CID 102763158
[3,5-dichloro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-pyridinyl]hydrazine (PubChem CID 102763158) has the molecular formula C8H5Cl2F6N3O and a molecular weight of 344.04 g/mol. Its IUPAC name is [3,5-dichloro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-pyridinyl]hydrazine.
| Compound Name | [3,5-dichloro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102763158 |
| Molecular Formula | C8H5Cl2F6N3O |
| Molecular Weight | 344.04 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | [3,5-dichloro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-pyridinyl]hydrazine |
| SMILES | NNc1nc(OC(C(F)(F)F)C(F)(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H5Cl2F6N3O/c9-2-1-3(10)5(18-4(2)19-17)20-6(7(11,12)13)8(14,15)16/h1,6H,17H2,(H,18,19) |
| InChIKey | SWHNVSTZBFHGCT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.04 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|