C11H17Cl2N3O — CID 102762740
[3,5-dichloro-6-(4-methylpentan-2-yloxy)-2-pyridinyl]hydrazine (PubChem CID 102762740) has the molecular formula C11H17Cl2N3O and a molecular weight of 278.18 g/mol. Its IUPAC name is [3,5-dichloro-6-(4-methylpentan-2-yloxy)-2-pyridinyl]hydrazine.
| Compound Name | [3,5-dichloro-6-(4-methylpentan-2-yloxy)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102762740 |
| Molecular Formula | C11H17Cl2N3O |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | [3,5-dichloro-6-(4-methylpentan-2-yloxy)-2-pyridinyl]hydrazine |
| SMILES | CC(C)CC(C)Oc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H17Cl2N3O/c1-6(2)4-7(3)17-11-9(13)5-8(12)10(15-11)16-14/h5-7H,4,14H2,1-3H3,(H,15,16) |
| InChIKey | MGMHVUAAMRERKM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|