C10H15Cl2N3O2 — CID 103491803
[3,5-dichloro-6-(1-ethoxypropan-2-yloxy)-2-pyridinyl]hydrazine (PubChem CID 103491803) has the molecular formula C10H15Cl2N3O2 and a molecular weight of 280.16 g/mol. Its IUPAC name is [3,5-dichloro-6-(1-ethoxypropan-2-yloxy)-2-pyridinyl]hydrazine.
| Compound Name | [3,5-dichloro-6-(1-ethoxypropan-2-yloxy)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 103491803 |
| Molecular Formula | C10H15Cl2N3O2 |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | [3,5-dichloro-6-(1-ethoxypropan-2-yloxy)-2-pyridinyl]hydrazine |
| SMILES | CCOCC(C)Oc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H15Cl2N3O2/c1-3-16-5-6(2)17-10-8(12)4-7(11)9(14-10)15-13/h4,6H,3,5,13H2,1-2H3,(H,14,15) |
| InChIKey | XJJPINCWBJSUJA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|