About 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine
3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine (PubChem CID 103488102) has the molecular formula C8H11Cl2N3O2
and a molecular weight of 252.10 g/mol. Its IUPAC name is 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine.
Molecular Properties
| Compound Name | 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine |
| PubChem CID | 103488102 |
| Molecular Formula | C8H11Cl2N3O2 |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine |
| SMILES | CCOCC(C)Oc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C8H11Cl2N3O2/c1-3-14-4-5(2)15-7-6(9)12-13-8(10)11-7/h5H,3-4H2,1-2H3 |
| InChIKey | YNCQWJFWXSPFRI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine?
The IUPAC name of 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine (CID 103488102) is 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine.
What is the SMILES notation for 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine?
The canonical SMILES for 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine is CCOCC(C)Oc1nc(Cl)nnc1Cl.
What is the InChIKey of 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine?
The InChIKey is YNCQWJFWXSPFRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11Cl2N3O2/c1-3-14-4-5(2)15-7-6(9)12-13-8(10)11-7/h5H,3-4H2,1-2H3.
What are the key properties of 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine?
3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine has a molecular weight of 252.10 g/mol, XLogP of 1.98, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloro-5-(1-ethoxypropan-2-yloxy)-1,2,4-triazine is sourced from PubChem (CID 103488102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).