C13H21F2N3O — CID 114073694
(3,5-difluoro-6-octan-2-yloxy-2-pyridinyl)hydrazine (PubChem CID 114073694) has the molecular formula C13H21F2N3O and a molecular weight of 273.33 g/mol. Its IUPAC name is (3,5-difluoro-6-octan-2-yloxy-2-pyridinyl)hydrazine.
| Compound Name | (3,5-difluoro-6-octan-2-yloxy-2-pyridinyl)hydrazine |
|---|---|
| PubChem CID | 114073694 |
| Molecular Formula | C13H21F2N3O |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (3,5-difluoro-6-octan-2-yloxy-2-pyridinyl)hydrazine |
| SMILES | CCCCCCC(C)Oc1nc(NN)c(F)cc1F |
| InChI | InChI=1S/C13H21F2N3O/c1-3-4-5-6-7-9(2)19-13-11(15)8-10(14)12(17-13)18-16/h8-9H,3-7,16H2,1-2H3,(H,17,18) |
| InChIKey | IYGNYFDFZULDNR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|