C12H18Cl2N2OS — CID 102761554
3-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]butan-1-ol (PubChem CID 102761554) has the molecular formula C12H18Cl2N2OS and a molecular weight of 309.26 g/mol. Its IUPAC name is 3-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]butan-1-ol.
| Compound Name | 3-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 102761554 |
| Molecular Formula | C12H18Cl2N2OS |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 3-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]butan-1-ol |
| SMILES | CCCNc1nc(SC(C)CCO)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N2OS/c1-3-5-15-11-9(13)7-10(14)12(16-11)18-8(2)4-6-17/h7-8,17H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | YHZZDOXPKAETHW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |