About methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate
methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate (PubChem CID 102761391) has the molecular formula C11H14Cl2N2O2S
and a molecular weight of 309.22 g/mol. Its IUPAC name is methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate |
| PubChem CID | 102761391 |
| Molecular Formula | C11H14Cl2N2O2S |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate |
| SMILES | CCCNc1nc(SCC(=O)OC)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O2S/c1-3-4-14-10-7(12)5-8(13)11(15-10)18-6-9(16)17-2/h5H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | YWMMHPDFVOUKRV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate?
The IUPAC name of methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate (CID 102761391) is methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate.
What is the SMILES notation for methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate?
The canonical SMILES for methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate is CCCNc1nc(SCC(=O)OC)c(Cl)cc1Cl.
What is the InChIKey of methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate?
The InChIKey is YWMMHPDFVOUKRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2N2O2S/c1-3-4-14-10-7(12)5-8(13)11(15-10)18-6-9(16)17-2/h5H,3-4,6H2,1-2H3,(H,14,15).
What are the key properties of methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate?
methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate has a molecular weight of 309.22 g/mol, XLogP of 3.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]sulfanyl]acetate is sourced from PubChem (CID 102761391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).